C32H41F3N2O10S — CID 67466464
3-[3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propanoylamino]pentanedioic acid;2,2,2-trifluoroacetic acid (PubChem CID 67466464) has the molecular formula C32H41F3N2O10S and a molecular weight of 702.74 g/mol. Its IUPAC name is 3-[3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propanoylamino]pentanedioic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propanoylamino]pentanedioic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67466464 |
| Molecular Formula | C32H41F3N2O10S |
| Molecular Weight | 702.74 g/mol |
| Exact Mass | 702.24 |
| IUPAC Name | 3-[3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propanoylamino]pentanedioic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CCC(=O)NC(CC(=O)O)CC(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H40N2O8S.C2HF3O2/c1-4-6-14-30(5-2)19-41(38,39)25-15-21(12-13-26(33)31-22(16-27(34)35)17-28(36)37)24(40-3)18-23(25)29(32-30)20-10-8-7-9-11-20;3-2(4,5)1(6)7/h7-11,15,18,22,29,32H,4-6,12-14,16-17,19H2,1-3H3,(H,31,33)(H,34,35)(H,36,37);(H,6,7)/t29-,30-;/m1./s1 |
| InChIKey | RYSBRYKVZQBXAV-GAQUOPITSA-N |
| XLogP | 4.50 |
| TPSA | 196.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.74 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |