C25H38N2O6S2 — CID 87410640
2-[[(3R,5R)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]ethanesulfonic acid (PubChem CID 87410640) has the molecular formula C25H38N2O6S2 and a molecular weight of 526.72 g/mol. Its IUPAC name is 2-[[(3R,5R)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]ethanesulfonic acid.
| Compound Name | 2-[[(3R,5R)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 87410640 |
| Molecular Formula | C25H38N2O6S2 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2-[[(3R,5R)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]ethanesulfonic acid |
| SMILES | CCCC[C@]1(CC)CS(O)(O)c2cc(CNCCS(=O)(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C25H38N2O6S2/c1-4-6-12-25(5-2)18-34(28,29)23-15-20(17-26-13-14-35(30,31)32)22(33-3)16-21(23)24(27-25)19-10-8-7-9-11-19/h7-11,15-16,24,26-29H,4-6,12-14,17-18H2,1-3H3,(H,30,31,32)/t24-,25-/m1/s1 |
| InChIKey | YSJDSBIPZNVBEO-JWQCQUIFSA-N |
| XLogP | 4.81 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|