C27H35F3N2O6S — CID 89396191
[2-[[(3R,5S)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]acetyl] 2,2,2-trifluoroacetate (PubChem CID 89396191) has the molecular formula C27H35F3N2O6S and a molecular weight of 572.65 g/mol. Its IUPAC name is [2-[[(3R,5S)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[[(3R,5S)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89396191 |
| Molecular Formula | C27H35F3N2O6S |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | [2-[[(3R,5S)-3-butyl-3-ethyl-1,1-dihydroxy-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ4,4-benzothiazepin-8-yl]methylamino]acetyl] 2,2,2-trifluoroacetate |
| SMILES | CCCC[C@]1(CC)CS(O)(O)c2cc(CNCC(=O)OC(=O)C(F)(F)F)c(OC)cc2[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C27H35F3N2O6S/c1-4-6-12-26(5-2)17-39(35,36)22-13-19(15-31-16-23(33)38-25(34)27(28,29)30)21(37-3)14-20(22)24(32-26)18-10-8-7-9-11-18/h7-11,13-14,24,31-32,35-36H,4-6,12,15-17H2,1-3H3/t24-,26+/m0/s1 |
| InChIKey | VHGIYWZIBCNQLL-AZGAKELHSA-N |
| XLogP | 5.56 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|