C23H33ClF3N3O2S2 — CID 142648898
[2-[2-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl-(2-sulfanylethyl)amino]ethylamino]-1-sulfanylethyl] 2,2,2-trifluoroacetate (PubChem CID 142648898) has the molecular formula C23H33ClF3N3O2S2 and a molecular weight of 540.12 g/mol. Its IUPAC name is [2-[2-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl-(2-sulfanylethyl)amino]ethylamino]-1-sulfanylethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl-(2-sulfanylethyl)amino]ethylamino]-1-sulfanylethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142648898 |
| Molecular Formula | C23H33ClF3N3O2S2 |
| Molecular Weight | 540.12 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | [2-[2-[[3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl-(2-sulfanylethyl)amino]ethylamino]-1-sulfanylethyl] 2,2,2-trifluoroacetate |
| SMILES | CN1C2CCC1C(CN(CCS)CCNCC(S)OC(=O)C(F)(F)F)C(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C23H33ClF3N3O2S2/c1-29-17-6-7-20(29)19(18(12-17)15-2-4-16(24)5-3-15)14-30(10-11-33)9-8-28-13-21(34)32-22(31)23(25,26)27/h2-5,17-21,28,33-34H,6-14H2,1H3 |
| InChIKey | ZKTAZILMRDHKLS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.12 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|