C22H35ClN4OS2 — CID 59957969
(2S,3S)-N-[2,3-bis(2-sulfanylethylamino)propyl]-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 59957969) has the molecular formula C22H35ClN4OS2 and a molecular weight of 471.14 g/mol. Its IUPAC name is (2S,3S)-N-[2,3-bis(2-sulfanylethylamino)propyl]-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,3S)-N-[2,3-bis(2-sulfanylethylamino)propyl]-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 59957969 |
| Molecular Formula | C22H35ClN4OS2 |
| Molecular Weight | 471.14 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (2S,3S)-N-[2,3-bis(2-sulfanylethylamino)propyl]-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | CN1C2CCC1[C@@H](C(=O)NCC(CNCCS)NCCS)[C@@H](c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C22H35ClN4OS2/c1-27-18-6-7-20(27)21(19(12-18)15-2-4-16(23)5-3-15)22(28)26-14-17(25-9-11-30)13-24-8-10-29/h2-5,17-21,24-25,29-30H,6-14H2,1H3,(H,26,28)/t17?,18?,19-,20?,21+/m1/s1 |
| InChIKey | FYVGBBOHMANXLS-OFQZUOMCSA-N |
| XLogP | 2.43 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.14 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|