C21H32ClN3OS2 — CID 59957967
(2S,3S)-3-(4-chlorophenyl)-8-methyl-N-(2-sulfanylethyl)-N-[2-(2-sulfanylethylamino)ethyl]-8-azabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 59957967) has the molecular formula C21H32ClN3OS2 and a molecular weight of 442.09 g/mol. Its IUPAC name is (2S,3S)-3-(4-chlorophenyl)-8-methyl-N-(2-sulfanylethyl)-N-[2-(2-sulfanylethylamino)ethyl]-8-azabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,3S)-3-(4-chlorophenyl)-8-methyl-N-(2-sulfanylethyl)-N-[2-(2-sulfanylethylamino)ethyl]-8-azabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 59957967 |
| Molecular Formula | C21H32ClN3OS2 |
| Molecular Weight | 442.09 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2S,3S)-3-(4-chlorophenyl)-8-methyl-N-(2-sulfanylethyl)-N-[2-(2-sulfanylethylamino)ethyl]-8-azabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | CN1C2CCC1[C@@H](C(=O)N(CCS)CCNCCS)[C@@H](c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C21H32ClN3OS2/c1-24-17-6-7-19(24)20(18(14-17)15-2-4-16(22)5-3-15)21(26)25(11-13-28)10-8-23-9-12-27/h2-5,17-20,23,27-28H,6-14H2,1H3/t17?,18-,19?,20+/m1/s1 |
| InChIKey | XKESPKOFKXKWBM-NBDWZHNGSA-N |
| XLogP | 3.18 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.09 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|