C20H22ClNO3 — CID 142651159
2-carbamoyl-2-[4-(4-chlorophenyl)phenyl]-3-ethylpentanoic acid (PubChem CID 142651159) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is 2-carbamoyl-2-[4-(4-chlorophenyl)phenyl]-3-ethylpentanoic acid.
| Compound Name | 2-carbamoyl-2-[4-(4-chlorophenyl)phenyl]-3-ethylpentanoic acid |
|---|---|
| PubChem CID | 142651159 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-carbamoyl-2-[4-(4-chlorophenyl)phenyl]-3-ethylpentanoic acid |
| SMILES | CCC(CC)C(C(N)=O)(C(=O)O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClNO3/c1-3-15(4-2)20(18(22)23,19(24)25)16-9-5-13(6-10-16)14-7-11-17(21)12-8-14/h5-12,15H,3-4H2,1-2H3,(H2,22,23)(H,24,25) |
| InChIKey | NVHJQOOKAKDWKU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|