C30H49NO4Si — CID 142652995
tert-butyl-[4,8-dimethyl-1-(2-methyl-1,3-benzoxazol-5-yl)-9-(oxan-2-yloxy)non-3-enoxy]-dimethylsilane (PubChem CID 142652995) has the molecular formula C30H49NO4Si and a molecular weight of 515.81 g/mol. Its IUPAC name is tert-butyl-[4,8-dimethyl-1-(2-methyl-1,3-benzoxazol-5-yl)-9-(oxan-2-yloxy)non-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4,8-dimethyl-1-(2-methyl-1,3-benzoxazol-5-yl)-9-(oxan-2-yloxy)non-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 142652995 |
| Molecular Formula | C30H49NO4Si |
| Molecular Weight | 515.81 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | tert-butyl-[4,8-dimethyl-1-(2-methyl-1,3-benzoxazol-5-yl)-9-(oxan-2-yloxy)non-3-enoxy]-dimethylsilane |
| SMILES | CC(=CCC(O[Si](C)(C)C(C)(C)C)c1ccc2oc(C)nc2c1)CCCC(C)COC1CCCCO1 |
| InChI | InChI=1S/C30H49NO4Si/c1-22(12-11-13-23(2)21-33-29-14-9-10-19-32-29)15-17-27(35-36(7,8)30(4,5)6)25-16-18-28-26(20-25)31-24(3)34-28/h15-16,18,20,23,27,29H,9-14,17,19,21H2,1-8H3 |
| InChIKey | IDZNIYFPXSKBJL-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 53.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.81 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|