C36H59NO6Si — CID 91394438
(3S,6R,7S,8S)-1-[tert-butyl(dimethyl)silyl]oxy-1,3,7-trihydroxy-4,4,8,12-tetramethyl-1-(2-methyl-1,3-benzoxazol-5-yl)-6-prop-2-enylpentadec-12-en-5-one (PubChem CID 91394438) has the molecular formula C36H59NO6Si and a molecular weight of 629.96 g/mol. Its IUPAC name is (3S,6R,7S,8S)-1-[tert-butyl(dimethyl)silyl]oxy-1,3,7-trihydroxy-4,4,8,12-tetramethyl-1-(2-methyl-1,3-benzoxazol-5-yl)-6-prop-2-enylpentadec-12-en-5-one.
| Compound Name | (3S,6R,7S,8S)-1-[tert-butyl(dimethyl)silyl]oxy-1,3,7-trihydroxy-4,4,8,12-tetramethyl-1-(2-methyl-1,3-benzoxazol-5-yl)-6-prop-2-enylpentadec-12-en-5-one |
|---|---|
| PubChem CID | 91394438 |
| Molecular Formula | C36H59NO6Si |
| Molecular Weight | 629.96 g/mol |
| Exact Mass | 629.41 |
| IUPAC Name | (3S,6R,7S,8S)-1-[tert-butyl(dimethyl)silyl]oxy-1,3,7-trihydroxy-4,4,8,12-tetramethyl-1-(2-methyl-1,3-benzoxazol-5-yl)-6-prop-2-enylpentadec-12-en-5-one |
| SMILES | C=CC[C@@H](C(=O)C(C)(C)[C@@H](O)CC(O)(O[Si](C)(C)C(C)(C)C)c1ccc2oc(C)nc2c1)[C@@H](O)[C@@H](C)CCCC(C)=CCC |
| InChI | InChI=1S/C36H59NO6Si/c1-13-16-24(3)18-15-19-25(4)32(39)28(17-14-2)33(40)35(9,10)31(38)23-36(41,43-44(11,12)34(6,7)8)27-20-21-30-29(22-27)37-26(5)42-30/h14,16,20-22,25,28,31-32,38-39,41H,2,13,15,17-19,23H2,1,3-12H3/t25-,28+,31-,32-,36?/m0/s1 |
| InChIKey | VIIQDERODVLPHY-IMOBUULDSA-N |
| XLogP | 8.37 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.96 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|