C42H71NO7Si2 — CID 91122992
(3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-4,4,8,12-tetramethyl-2-(2-methyl-1,3-benzoxazol-5-yl)-5-oxo-6-prop-2-enylpentadec-12-enoic acid (PubChem CID 91122992) has the molecular formula C42H71NO7Si2 and a molecular weight of 758.20 g/mol. Its IUPAC name is (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-4,4,8,12-tetramethyl-2-(2-methyl-1,3-benzoxazol-5-yl)-5-oxo-6-prop-2-enylpentadec-12-enoic acid.
| Compound Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-4,4,8,12-tetramethyl-2-(2-methyl-1,3-benzoxazol-5-yl)-5-oxo-6-prop-2-enylpentadec-12-enoic acid |
|---|---|
| PubChem CID | 91122992 |
| Molecular Formula | C42H71NO7Si2 |
| Molecular Weight | 758.20 g/mol |
| Exact Mass | 757.48 |
| IUPAC Name | (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-hydroxy-4,4,8,12-tetramethyl-2-(2-methyl-1,3-benzoxazol-5-yl)-5-oxo-6-prop-2-enylpentadec-12-enoic acid |
| SMILES | C=CC[C@@H](C(=O)C(C)(C)[C@H](O[Si](C)(C)C(C)(C)C)C(O)(C(=O)O)c1ccc2oc(C)nc2c1)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCCC(C)=CCC |
| InChI | InChI=1S/C42H71NO7Si2/c1-18-21-28(3)23-20-24-29(4)35(49-51(14,15)39(6,7)8)32(22-19-2)36(44)41(12,13)37(50-52(16,17)40(9,10)11)42(47,38(45)46)31-25-26-34-33(27-31)43-30(5)48-34/h19,21,25-27,29,32,35,37,47H,2,18,20,22-24H2,1,3-17H3,(H,45,46)/t29-,32+,35-,37-,42?/m0/s1 |
| InChIKey | JZAUPULAGWPRNA-DKNDXCCCSA-N |
| XLogP | 11.14 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.20 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|