C25H39NO2SSi — CID 102149939
(Z,2S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-9-(2-methyl-1,3-benzothiazol-5-yl)non-6-enal (PubChem CID 102149939) has the molecular formula C25H39NO2SSi and a molecular weight of 445.75 g/mol. Its IUPAC name is (Z,2S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-9-(2-methyl-1,3-benzothiazol-5-yl)non-6-enal.
| Compound Name | (Z,2S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-9-(2-methyl-1,3-benzothiazol-5-yl)non-6-enal |
|---|---|
| PubChem CID | 102149939 |
| Molecular Formula | C25H39NO2SSi |
| Molecular Weight | 445.75 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (Z,2S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-9-(2-methyl-1,3-benzothiazol-5-yl)non-6-enal |
| SMILES | C/C(=C/C[C@H](O[Si](C)(C)C(C)(C)C)c1ccc2sc(C)nc2c1)CCC[C@H](C)C=O |
| InChI | InChI=1S/C25H39NO2SSi/c1-18(10-9-11-19(2)17-27)12-14-23(28-30(7,8)25(4,5)6)21-13-15-24-22(16-21)26-20(3)29-24/h12-13,15-17,19,23H,9-11,14H2,1-8H3/b18-12-/t19-,23-/m0/s1 |
| InChIKey | FZAAEVOXTFQUTI-ZOUFMTEGSA-N |
| XLogP | 8.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.75 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|