C23H27FN2O7S — CID 142653985
ethyl 2-[4-(4-fluorophenoxy)phenyl]sulfonyl-2-[[1-(hydroxycarbamoyl)cyclopentyl]amino]propanoate (PubChem CID 142653985) has the molecular formula C23H27FN2O7S and a molecular weight of 494.54 g/mol. Its IUPAC name is ethyl 2-[4-(4-fluorophenoxy)phenyl]sulfonyl-2-[[1-(hydroxycarbamoyl)cyclopentyl]amino]propanoate.
| Compound Name | ethyl 2-[4-(4-fluorophenoxy)phenyl]sulfonyl-2-[[1-(hydroxycarbamoyl)cyclopentyl]amino]propanoate |
|---|---|
| PubChem CID | 142653985 |
| Molecular Formula | C23H27FN2O7S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | ethyl 2-[4-(4-fluorophenoxy)phenyl]sulfonyl-2-[[1-(hydroxycarbamoyl)cyclopentyl]amino]propanoate |
| SMILES | CCOC(=O)C(C)(NC1(C(=O)NO)CCCC1)S(=O)(=O)c1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H27FN2O7S/c1-3-32-21(28)22(2,26-23(20(27)25-29)14-4-5-15-23)34(30,31)19-12-10-18(11-13-19)33-17-8-6-16(24)7-9-17/h6-13,26,29H,3-5,14-15H2,1-2H3,(H,25,27) |
| InChIKey | MUJHSFOFMFWRIC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|