C30H42O7S — CID 142660649
2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-phenylsulfanyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone (PubChem CID 142660649) has the molecular formula C30H42O7S and a molecular weight of 546.73 g/mol. Its IUPAC name is 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-phenylsulfanyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone.
| Compound Name | 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-phenylsulfanyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
|---|---|
| PubChem CID | 142660649 |
| Molecular Formula | C30H42O7S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 2-ethyl-9-methoxy-1,5,7,9,11,13-hexamethyl-15-phenylsulfanyl-3,17-dioxabicyclo[12.3.0]heptadecane-4,6,12,16-tetrone |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)CC(C)(OC)CC(C)C(=O)C(C)C2C(Sc3ccccc3)C(=O)OC12C |
| InChI | InChI=1S/C30H42O7S/c1-9-22-30(7)23(26(28(34)37-30)38-21-13-11-10-12-14-21)19(4)24(31)17(2)15-29(6,35-8)16-18(3)25(32)20(5)27(33)36-22/h10-14,17-20,22-23,26H,9,15-16H2,1-8H3 |
| InChIKey | MRRMKAUMXMIIMY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|