C8H7N3O — CID 142662027
2-isocyanato-4,5-dimethyl-1H-pyrrole-3-carbonitrile (PubChem CID 142662027) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-isocyanato-4,5-dimethyl-1H-pyrrole-3-carbonitrile.
| Compound Name | 2-isocyanato-4,5-dimethyl-1H-pyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 142662027 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 2-isocyanato-4,5-dimethyl-1H-pyrrole-3-carbonitrile |
| SMILES | Cc1[nH]c(N=C=O)c(C#N)c1C |
| InChI | InChI=1S/C8H7N3O/c1-5-6(2)11-8(10-4-12)7(5)3-9/h11H,1-2H3 |
| InChIKey | FOHKZOXJDVLKFY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|