C20H26N2O4 — CID 142662808
butyl 4-[[4-(1,2-oxazol-3-yl)phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 142662808) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is butyl 4-[[4-(1,2-oxazol-3-yl)phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | butyl 4-[[4-(1,2-oxazol-3-yl)phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142662808 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | butyl 4-[[4-(1,2-oxazol-3-yl)phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(COc2ccc(-c3ccon3)cc2)CC1 |
| InChI | InChI=1S/C20H26N2O4/c1-2-3-13-24-20(23)22-11-8-16(9-12-22)15-25-18-6-4-17(5-7-18)19-10-14-26-21-19/h4-7,10,14,16H,2-3,8-9,11-13,15H2,1H3 |
| InChIKey | IGYDYLDLBWSEED-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|