C21H30N2O4 — CID 14989203
ethyl 4-[3-[4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenoxy]propyl]piperidine-1-carboxylate (PubChem CID 14989203) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is ethyl 4-[3-[4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenoxy]propyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-[4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenoxy]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 14989203 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | ethyl 4-[3-[4-(5,6-dihydro-4H-1,3-oxazin-2-yl)phenoxy]propyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(CCCOc2ccc(C3=NCCCO3)cc2)CC1 |
| InChI | InChI=1S/C21H30N2O4/c1-2-25-21(24)23-13-10-17(11-14-23)5-3-15-26-19-8-6-18(7-9-19)20-22-12-4-16-27-20/h6-9,17H,2-5,10-16H2,1H3 |
| InChIKey | IOCSVTIZFJTCCI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|