C29H24F3N3O4S — CID 142662835
(2R)-N-(3-methylsulfonyl-4-phenylphenyl)-3-phenyl-2-[(2,3,4-trifluorophenyl)carbamoylamino]propanamide (PubChem CID 142662835) has the molecular formula C29H24F3N3O4S and a molecular weight of 567.59 g/mol. Its IUPAC name is (2R)-N-(3-methylsulfonyl-4-phenylphenyl)-3-phenyl-2-[(2,3,4-trifluorophenyl)carbamoylamino]propanamide.
| Compound Name | (2R)-N-(3-methylsulfonyl-4-phenylphenyl)-3-phenyl-2-[(2,3,4-trifluorophenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 142662835 |
| Molecular Formula | C29H24F3N3O4S |
| Molecular Weight | 567.59 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | (2R)-N-(3-methylsulfonyl-4-phenylphenyl)-3-phenyl-2-[(2,3,4-trifluorophenyl)carbamoylamino]propanamide |
| SMILES | CS(=O)(=O)c1cc(NC(=O)[C@@H](Cc2ccccc2)NC(=O)Nc2ccc(F)c(F)c2F)ccc1-c1ccccc1 |
| InChI | InChI=1S/C29H24F3N3O4S/c1-40(38,39)25-17-20(12-13-21(25)19-10-6-3-7-11-19)33-28(36)24(16-18-8-4-2-5-9-18)35-29(37)34-23-15-14-22(30)26(31)27(23)32/h2-15,17,24H,16H2,1H3,(H,33,36)(H2,34,35,37)/t24-/m1/s1 |
| InChIKey | KCHFVJBNPGYMKT-XMMPIXPASA-N |
| XLogP | 5.55 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|