C14H19N5OS2 — CID 142663160
carbamimidoyl N-[4-(4-acetylpiperazin-1-yl)phenyl]carbamodithioate (PubChem CID 142663160) has the molecular formula C14H19N5OS2 and a molecular weight of 337.47 g/mol. Its IUPAC name is carbamimidoyl N-[4-(4-acetylpiperazin-1-yl)phenyl]carbamodithioate.
| Compound Name | carbamimidoyl N-[4-(4-acetylpiperazin-1-yl)phenyl]carbamodithioate |
|---|---|
| PubChem CID | 142663160 |
| Molecular Formula | C14H19N5OS2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | carbamimidoyl N-[4-(4-acetylpiperazin-1-yl)phenyl]carbamodithioate |
| SMILES | [H]/N=C(\N)SC(=S)Nc1ccc(N2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C14H19N5OS2/c1-10(20)18-6-8-19(9-7-18)12-4-2-11(3-5-12)17-14(21)22-13(15)16/h2-5H,6-9H2,1H3,(H3,15,16)(H,17,21) |
| InChIKey | SCNCMJXYLCXCBB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|