C22H24NO4P — CID 142664694
ethyl 1-oxo-1-(4-phenoxyphenyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[2,1-f]azaphosphinine-7-carboxylate (PubChem CID 142664694) has the molecular formula C22H24NO4P and a molecular weight of 397.41 g/mol. Its IUPAC name is ethyl 1-oxo-1-(4-phenoxyphenyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[2,1-f]azaphosphinine-7-carboxylate.
| Compound Name | ethyl 1-oxo-1-(4-phenoxyphenyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[2,1-f]azaphosphinine-7-carboxylate |
|---|---|
| PubChem CID | 142664694 |
| Molecular Formula | C22H24NO4P |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | ethyl 1-oxo-1-(4-phenoxyphenyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[2,1-f]azaphosphinine-7-carboxylate |
| SMILES | CCOC(=O)C1CCC2C=CCP(=O)(c3ccc(Oc4ccccc4)cc3)N21 |
| InChI | InChI=1S/C22H24NO4P/c1-2-26-22(24)21-15-10-17-7-6-16-28(25,23(17)21)20-13-11-19(12-14-20)27-18-8-4-3-5-9-18/h3-9,11-14,17,21H,2,10,15-16H2,1H3 |
| InChIKey | GOVFEFDKAVYIQV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|