C12H9N3O2 — CID 142665735
2-pyrrol-1-ylfuro[3,2-c]pyridine-6-carboxamide (PubChem CID 142665735) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-pyrrol-1-ylfuro[3,2-c]pyridine-6-carboxamide.
| Compound Name | 2-pyrrol-1-ylfuro[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 142665735 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-pyrrol-1-ylfuro[3,2-c]pyridine-6-carboxamide |
| SMILES | NC(=O)c1cc2oc(-n3cccc3)cc2cn1 |
| InChI | InChI=1S/C12H9N3O2/c13-12(16)9-6-10-8(7-14-9)5-11(17-10)15-3-1-2-4-15/h1-7H,(H2,13,16) |
| InChIKey | IVWQIRFMAVYXPV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |