C31H38N2O6 — CID 142667292
3-[3-[[4-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propoxy]phenyl]methylamino]phenyl]-2,2-diethoxypropanoic acid (PubChem CID 142667292) has the molecular formula C31H38N2O6 and a molecular weight of 534.65 g/mol. Its IUPAC name is 3-[3-[[4-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propoxy]phenyl]methylamino]phenyl]-2,2-diethoxypropanoic acid.
| Compound Name | 3-[3-[[4-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propoxy]phenyl]methylamino]phenyl]-2,2-diethoxypropanoic acid |
|---|---|
| PubChem CID | 142667292 |
| Molecular Formula | C31H38N2O6 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 3-[3-[[4-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propoxy]phenyl]methylamino]phenyl]-2,2-diethoxypropanoic acid |
| SMILES | CCOC(Cc1cccc(NCc2ccc(OCCCN3CCOc4ccccc43)cc2)c1)(OCC)C(=O)O |
| InChI | InChI=1S/C31H38N2O6/c1-3-38-31(30(34)35,39-4-2)22-25-9-7-10-26(21-25)32-23-24-13-15-27(16-14-24)36-19-8-17-33-18-20-37-29-12-6-5-11-28(29)33/h5-7,9-16,21,32H,3-4,8,17-20,22-23H2,1-2H3,(H,34,35) |
| InChIKey | ZRWFATOGGXAGBN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|