C24H29FN2O5 — CID 142672491
butyl 3-[(2-ethyl-4-isoquinolin-1-yl-4-oxobutanoyl)amino]-5-fluoro-4-oxopentanoate (PubChem CID 142672491) has the molecular formula C24H29FN2O5 and a molecular weight of 444.50 g/mol. Its IUPAC name is butyl 3-[(2-ethyl-4-isoquinolin-1-yl-4-oxobutanoyl)amino]-5-fluoro-4-oxopentanoate.
| Compound Name | butyl 3-[(2-ethyl-4-isoquinolin-1-yl-4-oxobutanoyl)amino]-5-fluoro-4-oxopentanoate |
|---|---|
| PubChem CID | 142672491 |
| Molecular Formula | C24H29FN2O5 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | butyl 3-[(2-ethyl-4-isoquinolin-1-yl-4-oxobutanoyl)amino]-5-fluoro-4-oxopentanoate |
| SMILES | CCCCOC(=O)CC(NC(=O)C(CC)CC(=O)c1nccc2ccccc12)C(=O)CF |
| InChI | InChI=1S/C24H29FN2O5/c1-3-5-12-32-22(30)14-19(21(29)15-25)27-24(31)16(4-2)13-20(28)23-18-9-7-6-8-17(18)10-11-26-23/h6-11,16,19H,3-5,12-15H2,1-2H3,(H,27,31) |
| InChIKey | UDRGCSFZORFCSV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|