C30H39FN2O5 — CID 164957057
octyl (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate (PubChem CID 164957057) has the molecular formula C30H39FN2O5 and a molecular weight of 526.65 g/mol. Its IUPAC name is octyl (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate.
| Compound Name | octyl (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate |
|---|---|
| PubChem CID | 164957057 |
| Molecular Formula | C30H39FN2O5 |
| Molecular Weight | 526.65 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | octyl (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate |
| SMILES | CCCCCCCCOC(=O)C[C@H](CC(=O)[C@]1(C(C)C)CC(c2nccc3ccccc23)=NO1)C(=O)CF |
| InChI | InChI=1S/C30H39FN2O5/c1-4-5-6-7-8-11-16-37-28(36)18-23(26(34)20-31)17-27(35)30(21(2)3)19-25(33-38-30)29-24-13-10-9-12-22(24)14-15-32-29/h9-10,12-15,21,23H,4-8,11,16-20H2,1-3H3/t23-,30+/m0/s1 |
| InChIKey | BHWYFJQPJGECII-YUDQIZAISA-N |
| XLogP | 6.16 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|