C29H37FN2O5 — CID 165065802
heptyl (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate (PubChem CID 165065802) has the molecular formula C29H37FN2O5 and a molecular weight of 512.62 g/mol. Its IUPAC name is heptyl (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate.
| Compound Name | heptyl (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate |
|---|---|
| PubChem CID | 165065802 |
| Molecular Formula | C29H37FN2O5 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | heptyl (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate |
| SMILES | CCCCCCCOC(=O)C[C@H](CC(=O)[C@]1(C(C)C)CC(c2nccc3ccccc23)=NO1)C(=O)CF |
| InChI | InChI=1S/C29H37FN2O5/c1-4-5-6-7-10-15-36-27(35)17-22(25(33)19-30)16-26(34)29(20(2)3)18-24(32-37-29)28-23-12-9-8-11-21(23)13-14-31-28/h8-9,11-14,20,22H,4-7,10,15-19H2,1-3H3/t22-,29+/m0/s1 |
| InChIKey | RYAXIEUVNDXMNW-PZGXJGMVSA-N |
| XLogP | 5.77 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|