C40H55FN2O5 — CID 165094427
[(9E,12E)-octadeca-9,12-dienyl] (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate (PubChem CID 165094427) has the molecular formula C40H55FN2O5 and a molecular weight of 662.89 g/mol. Its IUPAC name is [(9E,12E)-octadeca-9,12-dienyl] (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate.
| Compound Name | [(9E,12E)-octadeca-9,12-dienyl] (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate |
|---|---|
| PubChem CID | 165094427 |
| Molecular Formula | C40H55FN2O5 |
| Molecular Weight | 662.89 g/mol |
| Exact Mass | 662.41 |
| IUPAC Name | [(9E,12E)-octadeca-9,12-dienyl] (3S)-5-fluoro-3-[2-[(5R)-3-isoquinolin-1-yl-5-propan-2-yl-4H-1,2-oxazol-5-yl]-2-oxoethyl]-4-oxopentanoate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCOC(=O)C[C@H](CC(=O)[C@]1(C(C)C)CC(c2nccc3ccccc23)=NO1)C(=O)CF |
| InChI | InChI=1S/C40H55FN2O5/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-26-47-38(46)28-33(36(44)30-41)27-37(45)40(31(2)3)29-35(43-48-40)39-34-23-20-19-22-32(34)24-25-42-39/h8-9,11-12,19-20,22-25,31,33H,4-7,10,13-18,21,26-30H2,1-3H3/b9-8+,12-11+/t33-,40+/m0/s1 |
| InChIKey | XGHGQNVWLZZLHC-QVJCTGFBSA-N |
| XLogP | 9.61 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.89 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|