C19H22FN7O4 — CID 142673021
(5R)-3-[4-[4-(diethoxymethyl)triazol-1-yl]-3-fluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 142673021) has the molecular formula C19H22FN7O4 and a molecular weight of 431.43 g/mol. Its IUPAC name is (5R)-3-[4-[4-(diethoxymethyl)triazol-1-yl]-3-fluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[4-[4-(diethoxymethyl)triazol-1-yl]-3-fluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 142673021 |
| Molecular Formula | C19H22FN7O4 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (5R)-3-[4-[4-(diethoxymethyl)triazol-1-yl]-3-fluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CCOC(OCC)c1cn(-c2ccc(N3C[C@H](Cn4ccnn4)OC3=O)cc2F)nn1 |
| InChI | InChI=1S/C19H22FN7O4/c1-3-29-18(30-4-2)16-12-27(24-22-16)17-6-5-13(9-15(17)20)26-11-14(31-19(26)28)10-25-8-7-21-23-25/h5-9,12,14,18H,3-4,10-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | VHTNYEVSLGTWLB-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 109.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|