C22H29NO3S — CID 142673424
(2S)-2-methoxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-phenylpropanethioamide (PubChem CID 142673424) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is (2S)-2-methoxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-phenylpropanethioamide.
| Compound Name | (2S)-2-methoxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-phenylpropanethioamide |
|---|---|
| PubChem CID | 142673424 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (2S)-2-methoxy-N-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-3-phenylpropanethioamide |
| SMILES | COc1cc(CCNC(=S)[C@H](Cc2ccccc2)OC)ccc1OC(C)C |
| InChI | InChI=1S/C22H29NO3S/c1-16(2)26-19-11-10-18(14-20(19)24-3)12-13-23-22(27)21(25-4)15-17-8-6-5-7-9-17/h5-11,14,16,21H,12-13,15H2,1-4H3,(H,23,27)/t21-/m0/s1 |
| InChIKey | IDMVMSDSWRZSAU-NRFANRHFSA-N |
| XLogP | 4.20 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|