C16H30O2 — CID 142683527
4,4-dipentyl-1,2-dioxaspiro[2.5]octane (PubChem CID 142683527) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 4,4-dipentyl-1,2-dioxaspiro[2.5]octane.
| Compound Name | 4,4-dipentyl-1,2-dioxaspiro[2.5]octane |
|---|---|
| PubChem CID | 142683527 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 4,4-dipentyl-1,2-dioxaspiro[2.5]octane |
| SMILES | CCCCCC1(CCCCC)CCCCC12OO2 |
| InChI | InChI=1S/C16H30O2/c1-3-5-7-11-15(12-8-6-4-2)13-9-10-14-16(15)17-18-16/h3-14H2,1-2H3 |
| InChIKey | RWPIWNGZJVRBCR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|