C18H27FN4O5 — CID 142686781
N-[(2R,4S)-2-butyl-4-[(5-fluoro-3-hydroxy-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-hydroxyformamide (PubChem CID 142686781) has the molecular formula C18H27FN4O5 and a molecular weight of 398.44 g/mol. Its IUPAC name is N-[(2R,4S)-2-butyl-4-[(5-fluoro-3-hydroxy-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-hydroxyformamide.
| Compound Name | N-[(2R,4S)-2-butyl-4-[(5-fluoro-3-hydroxy-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 142686781 |
| Molecular Formula | C18H27FN4O5 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | N-[(2R,4S)-2-butyl-4-[(5-fluoro-3-hydroxy-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-hydroxyformamide |
| SMILES | CCCC[C@H](CN(O)C=O)C(=O)[C@@H](NC(=O)Nc1ncc(F)cc1O)C(C)C |
| InChI | InChI=1S/C18H27FN4O5/c1-4-5-6-12(9-23(28)10-24)16(26)15(11(2)3)21-18(27)22-17-14(25)7-13(19)8-20-17/h7-8,10-12,15,25,28H,4-6,9H2,1-3H3,(H2,20,21,22,27)/t12-,15+/m1/s1 |
| InChIKey | AHSDDOQGJZSMMY-DOMZBBRYSA-N |
| XLogP | 2.30 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|