C18H27FN4O5 — CID 91275289
[6-[[5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]carbamoylamino]-3-pyridinyl] hypofluorite (PubChem CID 91275289) has the molecular formula C18H27FN4O5 and a molecular weight of 398.44 g/mol. Its IUPAC name is [6-[[5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]carbamoylamino]-3-pyridinyl] hypofluorite.
| Compound Name | [6-[[5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]carbamoylamino]-3-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 91275289 |
| Molecular Formula | C18H27FN4O5 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [6-[[5-[[formyl(hydroxy)amino]methyl]-2-methyl-4-oxononan-3-yl]carbamoylamino]-3-pyridinyl] hypofluorite |
| SMILES | CCCCC(CN(O)C=O)C(=O)C(NC(=O)Nc1ccc(OF)cn1)C(C)C |
| InChI | InChI=1S/C18H27FN4O5/c1-4-5-6-13(10-23(27)11-24)17(25)16(12(2)3)22-18(26)21-15-8-7-14(28-19)9-20-15/h7-9,11-13,16,27H,4-6,10H2,1-3H3,(H2,20,21,22,26) |
| InChIKey | MUTDEUQEFYJYJX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|