C16H11ClN2O — CID 142688281
2-[2-(3-chloro-2-pyridinyl)but-3-ynyl]-1,3-benzoxazole (PubChem CID 142688281) has the molecular formula C16H11ClN2O and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-[2-(3-chloro-2-pyridinyl)but-3-ynyl]-1,3-benzoxazole.
| Compound Name | 2-[2-(3-chloro-2-pyridinyl)but-3-ynyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 142688281 |
| Molecular Formula | C16H11ClN2O |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 2-[2-(3-chloro-2-pyridinyl)but-3-ynyl]-1,3-benzoxazole |
| SMILES | C#CC(Cc1nc2ccccc2o1)c1ncccc1Cl |
| InChI | InChI=1S/C16H11ClN2O/c1-2-11(16-12(17)6-5-9-18-16)10-15-19-13-7-3-4-8-14(13)20-15/h1,3-9,11H,10H2 |
| InChIKey | ALZMUYWESKOUJV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|