C19H21N3O — CID 142689562
1-(2,6-dimethylphenyl)-1-(quinazolin-4-ylamino)propan-2-ol (PubChem CID 142689562) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-1-(quinazolin-4-ylamino)propan-2-ol.
| Compound Name | 1-(2,6-dimethylphenyl)-1-(quinazolin-4-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 142689562 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-1-(quinazolin-4-ylamino)propan-2-ol |
| SMILES | Cc1cccc(C)c1C(Nc1ncnc2ccccc12)C(C)O |
| InChI | InChI=1S/C19H21N3O/c1-12-7-6-8-13(2)17(12)18(14(3)23)22-19-15-9-4-5-10-16(15)20-11-21-19/h4-11,14,18,23H,1-3H3,(H,20,21,22) |
| InChIKey | QIPJRFRZLWTIKA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |