C23H39NO4 — CID 142693345
[3,3-dihydroxy-4-(4-octylphenyl)butan-2-yl] N-tert-butylcarbamate (PubChem CID 142693345) has the molecular formula C23H39NO4 and a molecular weight of 393.57 g/mol. Its IUPAC name is [3,3-dihydroxy-4-(4-octylphenyl)butan-2-yl] N-tert-butylcarbamate.
| Compound Name | [3,3-dihydroxy-4-(4-octylphenyl)butan-2-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 142693345 |
| Molecular Formula | C23H39NO4 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.29 |
| IUPAC Name | [3,3-dihydroxy-4-(4-octylphenyl)butan-2-yl] N-tert-butylcarbamate |
| SMILES | CCCCCCCCc1ccc(CC(O)(O)C(C)OC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H39NO4/c1-6-7-8-9-10-11-12-19-13-15-20(16-14-19)17-23(26,27)18(2)28-21(25)24-22(3,4)5/h13-16,18,26-27H,6-12,17H2,1-5H3,(H,24,25) |
| InChIKey | UPHATQYBPHWSKR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|