C21H27F5O — CID 142695428
6-(4-ethoxy-2,3-difluorophenyl)-7,8,8-trifluoro-2-propyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene (PubChem CID 142695428) has the molecular formula C21H27F5O and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-(4-ethoxy-2,3-difluorophenyl)-7,8,8-trifluoro-2-propyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene.
| Compound Name | 6-(4-ethoxy-2,3-difluorophenyl)-7,8,8-trifluoro-2-propyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene |
|---|---|
| PubChem CID | 142695428 |
| Molecular Formula | C21H27F5O |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 6-(4-ethoxy-2,3-difluorophenyl)-7,8,8-trifluoro-2-propyl-2,3,3a,4,5,6,7,8a-octahydro-1H-azulene |
| SMILES | CCCC1CC2CCC(c3ccc(OCC)c(F)c3F)C(F)C(F)(F)C2C1 |
| InChI | InChI=1S/C21H27F5O/c1-3-5-12-10-13-6-7-15(20(24)21(25,26)16(13)11-12)14-8-9-17(27-4-2)19(23)18(14)22/h8-9,12-13,15-16,20H,3-7,10-11H2,1-2H3 |
| InChIKey | YRCWMZWJWOSSMW-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |