C22H31F2NO — CID 129253055
N-[4-[4-(4-ethoxy-2,3-difluorophenyl)-3-methylcyclohexyl]cyclohexyl]methanimine (PubChem CID 129253055) has the molecular formula C22H31F2NO and a molecular weight of 363.49 g/mol. Its IUPAC name is N-[4-[4-(4-ethoxy-2,3-difluorophenyl)-3-methylcyclohexyl]cyclohexyl]methanimine.
| Compound Name | N-[4-[4-(4-ethoxy-2,3-difluorophenyl)-3-methylcyclohexyl]cyclohexyl]methanimine |
|---|---|
| PubChem CID | 129253055 |
| Molecular Formula | C22H31F2NO |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N-[4-[4-(4-ethoxy-2,3-difluorophenyl)-3-methylcyclohexyl]cyclohexyl]methanimine |
| SMILES | C=NC1CCC(C2CCC(c3ccc(OCC)c(F)c3F)C(C)C2)CC1 |
| InChI | InChI=1S/C22H31F2NO/c1-4-26-20-12-11-19(21(23)22(20)24)18-10-7-16(13-14(18)2)15-5-8-17(25-3)9-6-15/h11-12,14-18H,3-10,13H2,1-2H3 |
| InChIKey | KQMBAHAPMBWBKQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|