C18H19FIN5O — CID 142697505
N-(2-fluoro-4-iodophenyl)-4-[4-(oxolan-3-ylmethyl)-1,5-dihydro-1,2,4-triazol-3-yl]pyridin-3-amine (PubChem CID 142697505) has the molecular formula C18H19FIN5O and a molecular weight of 467.29 g/mol. Its IUPAC name is N-(2-fluoro-4-iodophenyl)-4-[4-(oxolan-3-ylmethyl)-1,5-dihydro-1,2,4-triazol-3-yl]pyridin-3-amine.
| Compound Name | N-(2-fluoro-4-iodophenyl)-4-[4-(oxolan-3-ylmethyl)-1,5-dihydro-1,2,4-triazol-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 142697505 |
| Molecular Formula | C18H19FIN5O |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | N-(2-fluoro-4-iodophenyl)-4-[4-(oxolan-3-ylmethyl)-1,5-dihydro-1,2,4-triazol-3-yl]pyridin-3-amine |
| SMILES | Fc1cc(I)ccc1Nc1cnccc1C1=NNCN1CC1CCOC1 |
| InChI | InChI=1S/C18H19FIN5O/c19-15-7-13(20)1-2-16(15)23-17-8-21-5-3-14(17)18-24-22-11-25(18)9-12-4-6-26-10-12/h1-3,5,7-8,12,22-23H,4,6,9-11H2 |
| InChIKey | JJHMPXXBLVMJGY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|