C9H12Cl2N2 — CID 142697834
4-(2-aminopropyl)-2,3-dichloroaniline (PubChem CID 142697834) has the molecular formula C9H12Cl2N2 and a molecular weight of 219.12 g/mol. Its IUPAC name is 4-(2-aminopropyl)-2,3-dichloroaniline.
| Compound Name | 4-(2-aminopropyl)-2,3-dichloroaniline |
|---|---|
| PubChem CID | 142697834 |
| Molecular Formula | C9H12Cl2N2 |
| Molecular Weight | 219.12 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 4-(2-aminopropyl)-2,3-dichloroaniline |
| SMILES | CC(N)Cc1ccc(N)c(Cl)c1Cl |
| InChI | InChI=1S/C9H12Cl2N2/c1-5(12)4-6-2-3-7(13)9(11)8(6)10/h2-3,5H,4,12-13H2,1H3 |
| InChIKey | MTROLYWPVWXEAC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.12 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|