About 3-buta-2,3-dien-2-ylquinoline
3-buta-2,3-dien-2-ylquinoline (PubChem CID 142698534) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-buta-2,3-dien-2-ylquinoline.
Molecular Properties
| Compound Name | 3-buta-2,3-dien-2-ylquinoline |
| PubChem CID | 142698534 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-buta-2,3-dien-2-ylquinoline |
| SMILES | C=C=C(C)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C13H11N/c1-3-10(2)12-8-11-6-4-5-7-13(11)14-9-12/h4-9H,1H2,2H3 |
| InChIKey | MHEVZOJXUZRUNY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-buta-2,3-dien-2-ylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-buta-2,3-dien-2-ylquinoline?
The IUPAC name of 3-buta-2,3-dien-2-ylquinoline (CID 142698534) is 3-buta-2,3-dien-2-ylquinoline.
What is the SMILES notation for 3-buta-2,3-dien-2-ylquinoline?
The canonical SMILES for 3-buta-2,3-dien-2-ylquinoline is C=C=C(C)c1cnc2ccccc2c1.
What is the InChIKey of 3-buta-2,3-dien-2-ylquinoline?
The InChIKey is MHEVZOJXUZRUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-3-10(2)12-8-11-6-4-5-7-13(11)14-9-12/h4-9H,1H2,2H3.
What are the key properties of 3-buta-2,3-dien-2-ylquinoline?
3-buta-2,3-dien-2-ylquinoline has a molecular weight of 181.24 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-buta-2,3-dien-2-ylquinoline is sourced from PubChem (CID 142698534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).