C13H11N — CID 142698534
3-buta-2,3-dien-2-ylquinoline (PubChem CID 142698534) has the molecular formula C13H11N and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-buta-2,3-dien-2-ylquinoline.
| Compound Name | 3-buta-2,3-dien-2-ylquinoline |
|---|---|
| PubChem CID | 142698534 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-buta-2,3-dien-2-ylquinoline |
| SMILES | C=C=C(C)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C13H11N/c1-3-10(2)12-8-11-6-4-5-7-13(11)14-9-12/h4-9H,1H2,2H3 |
| InChIKey | MHEVZOJXUZRUNY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |