About 1-quinolin-3-ylethene-1,2-dithiol
1-quinolin-3-ylethene-1,2-dithiol (PubChem CID 72543184) has the molecular formula C11H9NS2
and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-quinolin-3-ylethene-1,2-dithiol.
Molecular Properties
| Compound Name | 1-quinolin-3-ylethene-1,2-dithiol |
| PubChem CID | 72543184 |
| Molecular Formula | C11H9NS2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 1-quinolin-3-ylethene-1,2-dithiol |
| SMILES | SC=C(S)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C11H9NS2/c13-7-11(14)9-5-8-3-1-2-4-10(8)12-6-9/h1-7,13-14H |
| InChIKey | QBYXJUTWOAPKDE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-quinolin-3-ylethene-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-quinolin-3-ylethene-1,2-dithiol?
The IUPAC name of 1-quinolin-3-ylethene-1,2-dithiol (CID 72543184) is 1-quinolin-3-ylethene-1,2-dithiol.
What is the SMILES notation for 1-quinolin-3-ylethene-1,2-dithiol?
The canonical SMILES for 1-quinolin-3-ylethene-1,2-dithiol is SC=C(S)c1cnc2ccccc2c1.
What is the InChIKey of 1-quinolin-3-ylethene-1,2-dithiol?
The InChIKey is QBYXJUTWOAPKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NS2/c13-7-11(14)9-5-8-3-1-2-4-10(8)12-6-9/h1-7,13-14H.
What are the key properties of 1-quinolin-3-ylethene-1,2-dithiol?
1-quinolin-3-ylethene-1,2-dithiol has a molecular weight of 219.33 g/mol, XLogP of 3.39, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-quinolin-3-ylethene-1,2-dithiol is sourced from PubChem (CID 72543184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).