C28H23ClF3N3OS — CID 142701082
[2-amino-4-[[4-[2-(2,3,4-trifluorophenyl)phenyl]piperazin-1-yl]methyl]thiophen-3-yl]-(4-chlorophenyl)methanone (PubChem CID 142701082) has the molecular formula C28H23ClF3N3OS and a molecular weight of 542.03 g/mol. Its IUPAC name is [2-amino-4-[[4-[2-(2,3,4-trifluorophenyl)phenyl]piperazin-1-yl]methyl]thiophen-3-yl]-(4-chlorophenyl)methanone.
| Compound Name | [2-amino-4-[[4-[2-(2,3,4-trifluorophenyl)phenyl]piperazin-1-yl]methyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 142701082 |
| Molecular Formula | C28H23ClF3N3OS |
| Molecular Weight | 542.03 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | [2-amino-4-[[4-[2-(2,3,4-trifluorophenyl)phenyl]piperazin-1-yl]methyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
| SMILES | Nc1scc(CN2CCN(c3ccccc3-c3ccc(F)c(F)c3F)CC2)c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H23ClF3N3OS/c29-19-7-5-17(6-8-19)27(36)24-18(16-37-28(24)33)15-34-11-13-35(14-12-34)23-4-2-1-3-20(23)21-9-10-22(30)26(32)25(21)31/h1-10,16H,11-15,33H2 |
| InChIKey | DXJPGNPSWRWPDN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.03 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|