C7H12F2O5S — CID 142703089
1-(3,3-difluoro-2,2-dimethylpropanoyl)oxyethanesulfonic acid (PubChem CID 142703089) has the molecular formula C7H12F2O5S and a molecular weight of 246.23 g/mol. Its IUPAC name is 1-(3,3-difluoro-2,2-dimethylpropanoyl)oxyethanesulfonic acid.
| Compound Name | 1-(3,3-difluoro-2,2-dimethylpropanoyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 142703089 |
| Molecular Formula | C7H12F2O5S |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 1-(3,3-difluoro-2,2-dimethylpropanoyl)oxyethanesulfonic acid |
| SMILES | CC(OC(=O)C(C)(C)C(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C7H12F2O5S/c1-4(15(11,12)13)14-6(10)7(2,3)5(8)9/h4-5H,1-3H3,(H,11,12,13) |
| InChIKey | ORJJGKFEXFEQLV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|