C21H18N4O5 — CID 142704201
5-pyridin-1-ium-3-yl-3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazole nitrate (PubChem CID 142704201) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is 5-pyridin-1-ium-3-yl-3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazole nitrate.
| Compound Name | 5-pyridin-1-ium-3-yl-3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazole nitrate |
|---|---|
| PubChem CID | 142704201 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 5-pyridin-1-ium-3-yl-3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazole nitrate |
| SMILES | O=[N+]([O-])[O-].c1ccc(OCc2ccc(Cc3cc(-c4ccc[nH+]c4)on3)cc2)nc1 |
| InChI | InChI=1S/C21H17N3O2.NO3/c1-2-11-23-21(5-1)25-15-17-8-6-16(7-9-17)12-19-13-20(26-24-19)18-4-3-10-22-14-18;2-1(3)4/h1-11,13-14H,12,15H2;/q;-1/p+1 |
| InChIKey | XZXQIHXQDQNDHO-UHFFFAOYSA-O |
| XLogP | 3.48 |
| TPSA | 128.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|