C23H15FN4O7 — CID 175052236
2-[3-[3-[[4-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]methyl]-1,2-oxazol-5-yl]-2-pyridinyl]-1,3,5,2-trioxazinane-4,6-dione (PubChem CID 175052236) has the molecular formula C23H15FN4O7 and a molecular weight of 478.39 g/mol. Its IUPAC name is 2-[3-[3-[[4-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]methyl]-1,2-oxazol-5-yl]-2-pyridinyl]-1,3,5,2-trioxazinane-4,6-dione.
| Compound Name | 2-[3-[3-[[4-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]methyl]-1,2-oxazol-5-yl]-2-pyridinyl]-1,3,5,2-trioxazinane-4,6-dione |
|---|---|
| PubChem CID | 175052236 |
| Molecular Formula | C23H15FN4O7 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[3-[3-[[4-[(6-fluoro-2-pyridinyl)oxymethyl]phenyl]methyl]-1,2-oxazol-5-yl]-2-pyridinyl]-1,3,5,2-trioxazinane-4,6-dione |
| SMILES | O=C1OC(=O)ON(c2ncccc2-c2cc(Cc3ccc(COc4cccc(F)n4)cc3)no2)O1 |
| InChI | InChI=1S/C23H15FN4O7/c24-19-4-1-5-20(26-19)31-13-15-8-6-14(7-9-15)11-16-12-18(33-27-16)17-3-2-10-25-21(17)28-34-22(29)32-23(30)35-28/h1-10,12H,11,13H2 |
| InChIKey | YYEOSZPTUSIZPG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 126.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|