C8H12O7S — CID 142708140
2,7-dihydroxyhept-4-ynylsulfonyloxy formate (PubChem CID 142708140) has the molecular formula C8H12O7S and a molecular weight of 252.24 g/mol. Its IUPAC name is 2,7-dihydroxyhept-4-ynylsulfonyloxy formate.
| Compound Name | 2,7-dihydroxyhept-4-ynylsulfonyloxy formate |
|---|---|
| PubChem CID | 142708140 |
| Molecular Formula | C8H12O7S |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 2,7-dihydroxyhept-4-ynylsulfonyloxy formate |
| SMILES | O=COOS(=O)(=O)CC(O)CC#CCCO |
| InChI | InChI=1S/C8H12O7S/c9-5-3-1-2-4-8(11)6-16(12,13)15-14-7-10/h7-9,11H,3-6H2 |
| InChIKey | FPLGHRRVXHBZBL-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|