C7H12O4 — CID 71334474
3-(4-hydroxybut-1-ynoxy)propane-1,2-diol (PubChem CID 71334474) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 3-(4-hydroxybut-1-ynoxy)propane-1,2-diol.
| Compound Name | 3-(4-hydroxybut-1-ynoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 71334474 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3-(4-hydroxybut-1-ynoxy)propane-1,2-diol |
| SMILES | OCCC#COCC(O)CO |
| InChI | InChI=1S/C7H12O4/c8-3-1-2-4-11-6-7(10)5-9/h7-10H,1,3,5-6H2 |
| InChIKey | ZODONDCFHBJIKJ-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|