C41H55N3 — CID 142712915
2,6-bis[(2S)-3,3-dibutyl-2-phenyl-2,4-dihydropyrrol-5-yl]pyridine (PubChem CID 142712915) has the molecular formula C41H55N3 and a molecular weight of 589.91 g/mol. Its IUPAC name is 2,6-bis[(2S)-3,3-dibutyl-2-phenyl-2,4-dihydropyrrol-5-yl]pyridine.
| Compound Name | 2,6-bis[(2S)-3,3-dibutyl-2-phenyl-2,4-dihydropyrrol-5-yl]pyridine |
|---|---|
| PubChem CID | 142712915 |
| Molecular Formula | C41H55N3 |
| Molecular Weight | 589.91 g/mol |
| Exact Mass | 589.44 |
| IUPAC Name | 2,6-bis[(2S)-3,3-dibutyl-2-phenyl-2,4-dihydropyrrol-5-yl]pyridine |
| SMILES | CCCCC1(CCCC)CC(c2cccc(C3=N[C@H](c4ccccc4)C(CCCC)(CCCC)C3)n2)=N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C41H55N3/c1-5-9-26-40(27-10-6-2)30-36(43-38(40)32-20-15-13-16-21-32)34-24-19-25-35(42-34)37-31-41(28-11-7-3,29-12-8-4)39(44-37)33-22-17-14-18-23-33/h13-25,38-39H,5-12,26-31H2,1-4H3/t38-,39-/m1/s1 |
| InChIKey | PZIZGYPNUNOUEA-LJEWAXOPSA-N |
| XLogP | 11.68 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.91 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |