C17H20FN3OS — CID 142715593
[1-[3-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-methylpropan-2-yl]thiourea (PubChem CID 142715593) has the molecular formula C17H20FN3OS and a molecular weight of 333.43 g/mol. Its IUPAC name is [1-[3-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-methylpropan-2-yl]thiourea.
| Compound Name | [1-[3-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-methylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 142715593 |
| Molecular Formula | C17H20FN3OS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | [1-[3-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-methylpropan-2-yl]thiourea |
| SMILES | CC(C)(Cc1ncccc1OCc1cccc(F)c1)NC(N)=S |
| InChI | InChI=1S/C17H20FN3OS/c1-17(2,21-16(19)23)10-14-15(7-4-8-20-14)22-11-12-5-3-6-13(18)9-12/h3-9H,10-11H2,1-2H3,(H3,19,21,23) |
| InChIKey | FOZXNURPCYPPQW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|