C20H26FN5O2 — CID 142715563
[1-[3-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-(4-methylpiperazin-1-yl)ethyl]urea (PubChem CID 142715563) has the molecular formula C20H26FN5O2 and a molecular weight of 387.46 g/mol. Its IUPAC name is [1-[3-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-(4-methylpiperazin-1-yl)ethyl]urea.
| Compound Name | [1-[3-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-(4-methylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 142715563 |
| Molecular Formula | C20H26FN5O2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | [1-[3-[(3-fluorophenyl)methoxy]-2-pyridinyl]-2-(4-methylpiperazin-1-yl)ethyl]urea |
| SMILES | CN1CCN(CC(NC(N)=O)c2ncccc2OCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H26FN5O2/c1-25-8-10-26(11-9-25)13-17(24-20(22)27)19-18(6-3-7-23-19)28-14-15-4-2-5-16(21)12-15/h2-7,12,17H,8-11,13-14H2,1H3,(H3,22,24,27) |
| InChIKey | MIBPPVOESZNTHQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |