C20H15N3O4S2 — CID 142717654
N-(2-methoxyphenyl)-2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]acetamide (PubChem CID 142717654) has the molecular formula C20H15N3O4S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]acetamide |
|---|---|
| PubChem CID | 142717654 |
| Molecular Formula | C20H15N3O4S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]acetamide |
| SMILES | COc1ccccc1NC(=O)Cc1cncc2cc(/C=C3\SC(=S)NC3=O)oc12 |
| InChI | InChI=1S/C20H15N3O4S2/c1-26-15-5-3-2-4-14(15)22-17(24)7-12-10-21-9-11-6-13(27-18(11)12)8-16-19(25)23-20(28)29-16/h2-6,8-10H,7H2,1H3,(H,22,24)(H,23,25,28)/b16-8- |
| InChIKey | BVCGCWJDONDGOE-PXNMLYILSA-N |
| XLogP | 3.51 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|