C22H19N3O3S2 — CID 142717684
2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 142717684) has the molecular formula C22H19N3O3S2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 142717684 |
| Molecular Formula | C22H19N3O3S2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-[2-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]furo[3,2-c]pyridin-7-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(Cc1cncc2cc(/C=C3\SC(=S)NC3=O)oc12)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H19N3O3S2/c26-19(24-8-4-7-14-5-2-1-3-6-14)10-16-13-23-12-15-9-17(28-20(15)16)11-18-21(27)25-22(29)30-18/h1-3,5-6,9,11-13H,4,7-8,10H2,(H,24,26)(H,25,27,29)/b18-11- |
| InChIKey | LKFMIYNBKBIMOQ-WQRHYEAKSA-N |
| XLogP | 3.61 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|